C27H20FN2O+ — CID 164778803
6-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-3-phenyldibenzofuran-1-carbonitrile (PubChem CID 164778803) has the molecular formula C27H20FN2O+ and a molecular weight of 407.47 g/mol. Its IUPAC name is 6-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-3-phenyldibenzofuran-1-carbonitrile.
| Compound Name | 6-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-3-phenyldibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 164778803 |
| Molecular Formula | C27H20FN2O+ |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 6-(4-fluoro-1,5-dimethylpyridin-1-ium-2-yl)-7-methyl-3-phenyldibenzofuran-1-carbonitrile |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2cc(-c4ccccc4)cc(C#N)c23)cc1F |
| InChI | InChI=1S/C27H20FN2O/c1-16-9-10-21-26-20(14-29)11-19(18-7-5-4-6-8-18)12-24(26)31-27(21)25(16)23-13-22(28)17(2)15-30(23)3/h4-13,15H,1-3H3/q+1 |
| InChIKey | LIYVSSZHJWXJEX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|