C22H21FNO+ — CID 153464728
2-(7-fluoro-3,9-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 153464728) has the molecular formula C22H21FNO+ and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-(7-fluoro-3,9-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(7-fluoro-3,9-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 153464728 |
| Molecular Formula | C22H21FNO+ |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(7-fluoro-3,9-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2cc(F)cc(C)c23)[n+](C)cc1C |
| InChI | InChI=1S/C22H21FNO/c1-12-6-7-17-20-14(3)8-16(23)10-19(20)25-22(17)21(12)18-9-13(2)15(4)11-24(18)5/h6-11H,1-5H3/q+1 |
| InChIKey | SLBPGLZUSXEJPU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|