C29H34NO+ — CID 176822804
1,4,5-trimethyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium (PubChem CID 176822804) has the molecular formula C29H34NO+ and a molecular weight of 412.60 g/mol. Its IUPAC name is 1,4,5-trimethyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium.
| Compound Name | 1,4,5-trimethyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 176822804 |
| Molecular Formula | C29H34NO+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1,4,5-trimethyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c4c(ccc23)C(C)(C)CCC4(C)C)[n+](C)cc1C |
| InChI | InChI=1S/C29H34NO/c1-17-9-10-20-21-11-12-22-25(29(6,7)14-13-28(22,4)5)27(21)31-26(20)24(17)23-15-18(2)19(3)16-30(23)8/h9-12,15-16H,13-14H2,1-8H3/q+1 |
| InChIKey | KOFAEDJQOMAWFM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|