C36H42NOSi+ — CID 166051804
trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]silane (PubChem CID 166051804) has the molecular formula C36H42NOSi+ and a molecular weight of 532.82 g/mol. Its IUPAC name is trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]silane.
| Compound Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]silane |
|---|---|
| PubChem CID | 166051804 |
| Molecular Formula | C36H42NOSi+ |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]silane |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)C(C)(C)CCC5(C)C)c([Si](C)(C)C)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C36H42NOSi/c1-23-13-15-25-26-16-18-30(39(7,8)9)32(34(26)38-33(25)31(23)29-12-10-11-21-37(29)6)24-14-17-27-28(22-24)36(4,5)20-19-35(27,2)3/h10-18,21-22H,19-20H2,1-9H3/q+1 |
| InChIKey | YISLXQQUBMGRIN-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|