C33H36NOSi+ — CID 166051466
trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(1,1,3,3-tetradeuterio-2,2-dimethylinden-5-yl)dibenzofuran-2-yl]silane (PubChem CID 166051466) has the molecular formula C33H36NOSi+ and a molecular weight of 494.77 g/mol. Its IUPAC name is trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(1,1,3,3-tetradeuterio-2,2-dimethylinden-5-yl)dibenzofuran-2-yl]silane.
| Compound Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(1,1,3,3-tetradeuterio-2,2-dimethylinden-5-yl)dibenzofuran-2-yl]silane |
|---|---|
| PubChem CID | 166051466 |
| Molecular Formula | C33H36NOSi+ |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(1,1,3,3-tetradeuterio-2,2-dimethylinden-5-yl)dibenzofuran-2-yl]silane |
| SMILES | [2H]C1([2H])c2ccc(-c3cc([Si](C)(C)C)cc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)cc2C([2H])([2H])C1(C)C |
| InChI | InChI=1S/C33H36NOSi/c1-21-11-14-26-28-18-25(36(5,6)7)17-27(22-12-13-23-19-33(2,3)20-24(23)16-22)31(28)35-32(26)30(21)29-10-8-9-15-34(29)4/h8-18H,19-20H2,1-7H3/q+1/i19D2,20D2 |
| InChIKey | LHQWBBVCUCZBPO-SKIVKWGGSA-N |
| XLogP | 7.72 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|