C30H27FNO+ — CID 167357350
2-[8-(2,2-dimethyl-1,3-dihydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 167357350) has the molecular formula C30H27FNO+ and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[8-(2,2-dimethyl-1,3-dihydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[8-(2,2-dimethyl-1,3-dihydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167357350 |
| Molecular Formula | C30H27FNO+ |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[8-(2,2-dimethyl-1,3-dihydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc(F)c(-c4ccc5c(c4)CC(C)(C)C5)cc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C30H27FNO/c1-18-8-11-22-24-14-23(19-9-10-20-16-30(2,3)17-21(20)13-19)25(31)15-27(24)33-29(22)28(18)26-7-5-6-12-32(26)4/h5-15H,16-17H2,1-4H3/q+1 |
| InChIKey | MEUBLSFOEMNBJM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|