C32H34NO+ — CID 176822447
1,5-dimethyl-2-(7,15,15,18,18-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl)pyridin-1-ium (PubChem CID 176822447) has the molecular formula C32H34NO+ and a molecular weight of 448.63 g/mol. Its IUPAC name is 1,5-dimethyl-2-(7,15,15,18,18-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl)pyridin-1-ium.
| Compound Name | 1,5-dimethyl-2-(7,15,15,18,18-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 176822447 |
| Molecular Formula | C32H34NO+ |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 1,5-dimethyl-2-(7,15,15,18,18-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl)pyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)ccc3c2oc2cc4c5c(ccc4cc23)C(C)(C)CCC5(C)C)[n+](C)c1 |
| InChI | InChI=1S/C32H34NO/c1-19-8-13-26(33(7)18-19)28-20(2)9-11-22-24-16-21-10-12-25-29(23(21)17-27(24)34-30(22)28)32(5,6)15-14-31(25,3)4/h8-13,16-18H,14-15H2,1-7H3/q+1 |
| InChIKey | CUJZLLYXNSMNPI-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|