C33H36NO+ — CID 176822565
1-methyl-2-[7,15,15,18,18-pentamethyl-5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl]-4-(trideuteriomethyl)pyridin-1-ium (PubChem CID 176822565) has the molecular formula C33H36NO+ and a molecular weight of 468.69 g/mol. Its IUPAC name is 1-methyl-2-[7,15,15,18,18-pentamethyl-5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl]-4-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[7,15,15,18,18-pentamethyl-5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl]-4-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 176822565 |
| Molecular Formula | C33H36NO+ |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-methyl-2-[7,15,15,18,18-pentamethyl-5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaen-8-yl]-4-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc[n+](C)c(-c2c(C)cc(C([2H])([2H])[2H])c3c2oc2cc4c5c(ccc4cc23)C(C)(C)CCC5(C)C)c1 |
| InChI | InChI=1S/C33H36NO/c1-19-11-14-34(8)26(15-19)29-21(3)16-20(2)28-24-17-22-9-10-25-30(23(22)18-27(24)35-31(28)29)33(6,7)13-12-32(25,4)5/h9-11,14-18H,12-13H2,1-8H3/q+1/i1D3,2D3 |
| InChIKey | KKOHGGCBUXSILU-WFGJKAKNSA-N |
| XLogP | 8.50 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|