C31H33N2O+ — CID 176822700
1,3-dimethyl-4-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[2,3-b]quinoline (PubChem CID 176822700) has the molecular formula C31H33N2O+ and a molecular weight of 449.62 g/mol. Its IUPAC name is 1,3-dimethyl-4-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 1,3-dimethyl-4-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 176822700 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 1,3-dimethyl-4-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[2,3-b]quinoline |
| SMILES | Cc1cc(C)c2c(oc3nc4ccccc4cc32)c1-c1c2c(cc[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H33N2O/c1-18-16-19(2)25(27-26-22(12-15-33(27)7)30(3,4)13-14-31(26,5)6)28-24(18)21-17-20-10-8-9-11-23(20)32-29(21)34-28/h8-12,15-17H,13-14H2,1-7H3/q+1 |
| InChIKey | YVOGVAIWGCYBNU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|