C21H18N3O+ — CID 140827931
4-(1,3-dimethylimidazol-1-ium-2-yl)-3-methyl-[1]benzofuro[2,3-b]quinoline (PubChem CID 140827931) has the molecular formula C21H18N3O+ and a molecular weight of 328.40 g/mol. Its IUPAC name is 4-(1,3-dimethylimidazol-1-ium-2-yl)-3-methyl-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 4-(1,3-dimethylimidazol-1-ium-2-yl)-3-methyl-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 140827931 |
| Molecular Formula | C21H18N3O+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-(1,3-dimethylimidazol-1-ium-2-yl)-3-methyl-[1]benzofuro[2,3-b]quinoline |
| SMILES | Cc1ccc2c(oc3nc4ccccc4cc32)c1-c1n(C)cc[n+]1C |
| InChI | InChI=1S/C21H18N3O/c1-13-8-9-15-16-12-14-6-4-5-7-17(14)22-20(16)25-19(15)18(13)21-23(2)10-11-24(21)3/h4-12H,1-3H3/q+1 |
| InChIKey | ZRTGMZILNMUWSM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|