C19H16N3O+ — CID 176787666
6-(1,3-dimethylimidazol-1-ium-2-yl)-7-methyldibenzofuran-4-carbonitrile (PubChem CID 176787666) has the molecular formula C19H16N3O+ and a molecular weight of 302.36 g/mol. Its IUPAC name is 6-(1,3-dimethylimidazol-1-ium-2-yl)-7-methyldibenzofuran-4-carbonitrile.
| Compound Name | 6-(1,3-dimethylimidazol-1-ium-2-yl)-7-methyldibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 176787666 |
| Molecular Formula | C19H16N3O+ |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-(1,3-dimethylimidazol-1-ium-2-yl)-7-methyldibenzofuran-4-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(C#N)cccc32)c1-c1n(C)cc[n+]1C |
| InChI | InChI=1S/C19H16N3O/c1-12-7-8-15-14-6-4-5-13(11-20)17(14)23-18(15)16(12)19-21(2)9-10-22(19)3/h4-10H,1-3H3/q+1 |
| InChIKey | JGURFGGKOBBOKD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|