C33H21N4O+ — CID 168794174
9-[3-cyano-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole-1-carbonitrile (PubChem CID 168794174) has the molecular formula C33H21N4O+ and a molecular weight of 489.56 g/mol. Its IUPAC name is 9-[3-cyano-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole-1-carbonitrile.
| Compound Name | 9-[3-cyano-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole-1-carbonitrile |
|---|---|
| PubChem CID | 168794174 |
| Molecular Formula | C33H21N4O+ |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 9-[3-cyano-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole-1-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-n4c5ccccc5c5cccc(C#N)c54)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C33H21N4O/c1-20-13-15-25-26-16-14-22(19-35)31(33(26)38-32(25)29(20)28-12-5-6-17-36(28)2)37-27-11-4-3-9-23(27)24-10-7-8-21(18-34)30(24)37/h3-17H,1-2H3/q+1 |
| InChIKey | RGGMQSFLCJVJQM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|