C31H20F3N2O+ — CID 168794128
4,5-difluoro-9-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole (PubChem CID 168794128) has the molecular formula C31H20F3N2O+ and a molecular weight of 493.51 g/mol. Its IUPAC name is 4,5-difluoro-9-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole.
| Compound Name | 4,5-difluoro-9-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole |
|---|---|
| PubChem CID | 168794128 |
| Molecular Formula | C31H20F3N2O+ |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 4,5-difluoro-9-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]carbazole |
| SMILES | Cc1ccc2c(oc3c(-n4c5cccc(F)c5c5c(F)cccc54)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C31H20F3N2O/c1-17-12-13-18-19-14-15-22(34)29(31(19)37-30(18)26(17)23-9-3-4-16-35(23)2)36-24-10-5-7-20(32)27(24)28-21(33)8-6-11-25(28)36/h3-16H,1-2H3/q+1 |
| InChIKey | YOBHWSVXYLGVGR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|