C29H27GeN2O+ — CID 166043450
2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-5-trimethylgermylbenzonitrile (PubChem CID 166043450) has the molecular formula C29H27GeN2O+ and a molecular weight of 492.16 g/mol. Its IUPAC name is 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-5-trimethylgermylbenzonitrile.
| Compound Name | 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-5-trimethylgermylbenzonitrile |
|---|---|
| PubChem CID | 166043450 |
| Molecular Formula | C29H27GeN2O+ |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-5-trimethylgermylbenzonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc([Ge](C)(C)C)cc4C#N)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C29H27GeN2O/c1-19-12-14-25-24-10-8-9-23(22-15-13-21(30(2,3)4)17-20(22)18-31)28(24)33-29(25)27(19)26-11-6-7-16-32(26)5/h6-17H,1-5H3/q+1 |
| InChIKey | XZANGKHTPOMDRK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|