C28H23N2O+ — CID 162505753
7-methyl-4-phenyl-6-(1,3,4-trimethylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 162505753) has the molecular formula C28H23N2O+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 7-methyl-4-phenyl-6-(1,3,4-trimethylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-4-phenyl-6-(1,3,4-trimethylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 162505753 |
| Molecular Formula | C28H23N2O+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 7-methyl-4-phenyl-6-(1,3,4-trimethylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2c(-c4ccccc4)c(C#N)ccc23)c1C |
| InChI | InChI=1S/C28H23N2O/c1-17-14-15-30(4)26(19(17)3)24-18(2)10-12-22-23-13-11-21(16-29)25(28(23)31-27(22)24)20-8-6-5-7-9-20/h5-15H,1-4H3/q+1 |
| InChIKey | HJQZBIFYXYXQJC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|