C24H19N2O2+ — CID 176787528
1,3-dimethyl-2-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)imidazol-1-ium (PubChem CID 176787528) has the molecular formula C24H19N2O2+ and a molecular weight of 367.43 g/mol. Its IUPAC name is 1,3-dimethyl-2-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)imidazol-1-ium.
| Compound Name | 1,3-dimethyl-2-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 176787528 |
| Molecular Formula | C24H19N2O2+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1,3-dimethyl-2-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)imidazol-1-ium |
| SMILES | Cc1ccc2c(oc3ccc4oc5ccccc5c4c32)c1-c1n(C)cc[n+]1C |
| InChI | InChI=1S/C24H19N2O2/c1-14-8-9-16-22-19(28-23(16)20(14)24-25(2)12-13-26(24)3)11-10-18-21(22)15-6-4-5-7-17(15)27-18/h4-13H,1-3H3/q+1 |
| InChIKey | OAAIKBGNWWPOPJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|