C20H15N2O2+ — CID 140828050
1-methyl-2-(2-methyl-[1]benzofuro[3,2-b][1]benzofuran-1-yl)pyrimidin-1-ium (PubChem CID 140828050) has the molecular formula C20H15N2O2+ and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-[1]benzofuro[3,2-b][1]benzofuran-1-yl)pyrimidin-1-ium.
| Compound Name | 1-methyl-2-(2-methyl-[1]benzofuro[3,2-b][1]benzofuran-1-yl)pyrimidin-1-ium |
|---|---|
| PubChem CID | 140828050 |
| Molecular Formula | C20H15N2O2+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-methyl-2-(2-methyl-[1]benzofuro[3,2-b][1]benzofuran-1-yl)pyrimidin-1-ium |
| SMILES | Cc1ccc2c(oc3c4ccccc4oc23)c1-c1nccc[n+]1C |
| InChI | InChI=1S/C20H15N2O2/c1-12-8-9-14-17(16(12)20-21-10-5-11-22(20)2)24-18-13-6-3-4-7-15(13)23-19(14)18/h3-11H,1-2H3/q+1 |
| InChIKey | UYFHOTWUXCQBRX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|