C25H28N3O+ — CID 176823005
1,1,4,4,9-pentamethyl-8-(1-methylpyrimidin-1-ium-2-yl)-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline (PubChem CID 176823005) has the molecular formula C25H28N3O+ and a molecular weight of 386.52 g/mol. Its IUPAC name is 1,1,4,4,9-pentamethyl-8-(1-methylpyrimidin-1-ium-2-yl)-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline.
| Compound Name | 1,1,4,4,9-pentamethyl-8-(1-methylpyrimidin-1-ium-2-yl)-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 176823005 |
| Molecular Formula | C25H28N3O+ |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1,1,4,4,9-pentamethyl-8-(1-methylpyrimidin-1-ium-2-yl)-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline |
| SMILES | Cc1ccc2c(oc3ncc4c(c32)C(C)(C)CCC4(C)C)c1-c1nccc[n+]1C |
| InChI | InChI=1S/C25H28N3O/c1-15-8-9-16-19-20-17(24(2,3)10-11-25(20,4)5)14-27-23(19)29-21(16)18(15)22-26-12-7-13-28(22)6/h7-9,12-14H,10-11H2,1-6H3/q+1 |
| InChIKey | QIVQYFPMGOLWJQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|