C27H23N2O+ — CID 154007172
6,20,20-trimethyl-7-(1-methylpyridin-1-ium-2-yl)-9-oxa-11-azapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14,16,18-nonaene (PubChem CID 154007172) has the molecular formula C27H23N2O+ and a molecular weight of 391.49 g/mol. Its IUPAC name is 6,20,20-trimethyl-7-(1-methylpyridin-1-ium-2-yl)-9-oxa-11-azapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14,16,18-nonaene.
| Compound Name | 6,20,20-trimethyl-7-(1-methylpyridin-1-ium-2-yl)-9-oxa-11-azapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 154007172 |
| Molecular Formula | C27H23N2O+ |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 6,20,20-trimethyl-7-(1-methylpyridin-1-ium-2-yl)-9-oxa-11-azapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14,16,18-nonaene |
| SMILES | Cc1ccc2c(oc3ncc4c(c32)C(C)(C)c2ccccc2-4)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H23N2O/c1-16-12-13-18-23-24-19(17-9-5-6-10-20(17)27(24,2)3)15-28-26(23)30-25(18)22(16)21-11-7-8-14-29(21)4/h5-15H,1-4H3/q+1 |
| InChIKey | NLXAYKPYQFEYPB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|