C39H27N2O+ — CID 169077077
2-[9-isocyano-3-methyl-6-(9-phenylfluoren-9-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 169077077) has the molecular formula C39H27N2O+ and a molecular weight of 539.66 g/mol. Its IUPAC name is 2-[9-isocyano-3-methyl-6-(9-phenylfluoren-9-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[9-isocyano-3-methyl-6-(9-phenylfluoren-9-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169077077 |
| Molecular Formula | C39H27N2O+ |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[9-isocyano-3-methyl-6-(9-phenylfluoren-9-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc(C2(c3ccccc3)c3ccccc3-c3ccccc32)c2oc3c(-c4cccc[n+]4C)c(C)ccc3c12 |
| InChI | InChI=1S/C39H27N2O/c1-25-20-21-29-36-33(40-2)23-22-32(38(36)42-37(29)35(25)34-19-11-12-24-41(34)3)39(26-13-5-4-6-14-26)30-17-9-7-15-27(30)28-16-8-10-18-31(28)39/h4-24H,1,3H3/q+1 |
| InChIKey | XXDZIZSGFMXCDU-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|