C23H21N2O+ — CID 154616078
2-(7-isocyano-2-methyl-6-propan-2-yldibenzofuran-1-yl)-1-methylpyridin-1-ium (PubChem CID 154616078) has the molecular formula C23H21N2O+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-(7-isocyano-2-methyl-6-propan-2-yldibenzofuran-1-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(7-isocyano-2-methyl-6-propan-2-yldibenzofuran-1-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154616078 |
| Molecular Formula | C23H21N2O+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-(7-isocyano-2-methyl-6-propan-2-yldibenzofuran-1-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3ccc(C)c(-c4cccc[n+]4C)c32)c1C(C)C |
| InChI | InChI=1S/C23H21N2O/c1-14(2)20-17(24-4)11-10-16-22-19(26-23(16)20)12-9-15(3)21(22)18-8-6-7-13-25(18)5/h6-14H,1-3,5H3/q+1 |
| InChIKey | WGQCCYJTVOJJIY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|