C20H14FN2O+ — CID 154615774
2-(9-fluoro-8-isocyano-2-methyldibenzofuran-1-yl)-1-methylpyridin-1-ium (PubChem CID 154615774) has the molecular formula C20H14FN2O+ and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(9-fluoro-8-isocyano-2-methyldibenzofuran-1-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(9-fluoro-8-isocyano-2-methyldibenzofuran-1-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154615774 |
| Molecular Formula | C20H14FN2O+ |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(9-fluoro-8-isocyano-2-methyldibenzofuran-1-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2oc3ccc(C)c(-c4cccc[n+]4C)c3c2c1F |
| InChI | InChI=1S/C20H14FN2O/c1-12-7-9-15-18(17(12)14-6-4-5-11-23(14)3)19-16(24-15)10-8-13(22-2)20(19)21/h4-11H,1,3H3/q+1 |
| InChIKey | LGTXDBVPNPXOMS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|