C27H21N2O+ — CID 154615525
2-[8-isocyano-3-methyl-9-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 154615525) has the molecular formula C27H21N2O+ and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[8-isocyano-3-methyl-9-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[8-isocyano-3-methyl-9-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154615525 |
| Molecular Formula | C27H21N2O+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[8-isocyano-3-methyl-9-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2oc3c(-c4cccc[n+]4C)c(C)ccc3c2c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C27H21N2O/c1-17-8-11-19(12-9-17)25-21(28-3)14-15-23-26(25)20-13-10-18(2)24(27(20)30-23)22-7-5-6-16-29(22)4/h5-16H,1-2,4H3/q+1 |
| InChIKey | KEIPRJSYOHROKV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|