C28H23N2O+ — CID 154615938
2-[7-(2,4-dimethylphenyl)-6-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 154615938) has the molecular formula C28H23N2O+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-[7-(2,4-dimethylphenyl)-6-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-(2,4-dimethylphenyl)-6-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154615938 |
| Molecular Formula | C28H23N2O+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[7-(2,4-dimethylphenyl)-6-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1c(-c2ccc(C)cc2C)ccc2c1oc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C28H23N2O/c1-17-9-11-20(19(3)16-17)21-13-14-23-22-12-10-18(2)25(24-8-6-7-15-30(24)5)27(22)31-28(23)26(21)29-4/h6-16H,1-3,5H3/q+1 |
| InChIKey | KYTDOTDBLQZXOZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|