C31H31N2O+ — CID 156661855
14,14-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene (PubChem CID 156661855) has the molecular formula C31H31N2O+ and a molecular weight of 461.69 g/mol. Its IUPAC name is 14,14-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene.
| Compound Name | 14,14-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 156661855 |
| Molecular Formula | C31H31N2O+ |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | 14,14-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C1(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c2ccccc2-c2cc3c(nc21)oc1c(-c2cccc[n+]2C)c(C)ccc13 |
| InChI | InChI=1S/C31H31N2O/c1-18(2)31(19(3)4)25-12-8-7-11-21(25)23-17-24-22-15-14-20(5)27(26-13-9-10-16-33(26)6)28(22)34-30(24)32-29(23)31/h7-19H,1-6H3/q+1/i1D3,2D3,3D3,4D3,18D,19D |
| InChIKey | XQVKXFVCUVLIFE-JMNIFWNYSA-N |
| XLogP | 7.36 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|