C34H43N2O+ — CID 176822835
8-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-1,1,4,4,9,10-hexamethyl-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline (PubChem CID 176822835) has the molecular formula C34H43N2O+ and a molecular weight of 497.74 g/mol. Its IUPAC name is 8-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-1,1,4,4,9,10-hexamethyl-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline.
| Compound Name | 8-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-1,1,4,4,9,10-hexamethyl-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 176822835 |
| Molecular Formula | C34H43N2O+ |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | 8-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-1,1,4,4,9,10-hexamethyl-2,3-dihydro-[1]benzofuro[2,3-c]isoquinoline |
| SMILES | [2H]C([2H])(c1cc[n+](C)c(-c2c(C)c(C)cc3c2oc2ncc4c(c23)C(C)(C)CCC4(C)C)c1)C1CCCCC1 |
| InChI | InChI=1S/C34H43N2O/c1-21-17-25-29-30-26(33(3,4)14-15-34(30,5)6)20-35-32(29)37-31(25)28(22(21)2)27-19-24(13-16-36(27)7)18-23-11-9-8-10-12-23/h13,16-17,19-20,23H,8-12,14-15,18H2,1-7H3/q+1/i18D2 |
| InChIKey | FAQPGGYBCSIFHI-CPLZMPMBSA-N |
| XLogP | 8.56 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|