C36H41N2O+ — CID 176822614
8-[4-[cyclopentyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-7,15,15,18,18-pentamethyl-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaene (PubChem CID 176822614) has the molecular formula C36H41N2O+ and a molecular weight of 519.75 g/mol. Its IUPAC name is 8-[4-[cyclopentyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-7,15,15,18,18-pentamethyl-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaene.
| Compound Name | 8-[4-[cyclopentyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-7,15,15,18,18-pentamethyl-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaene |
|---|---|
| PubChem CID | 176822614 |
| Molecular Formula | C36H41N2O+ |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | 8-[4-[cyclopentyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-7,15,15,18,18-pentamethyl-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),20-octaene |
| SMILES | [2H]C([2H])(c1cc[n+](C)c(-c2c(C)ccc3c2oc2nc4c5c(ccc4cc23)C(C)(C)CCC5(C)C)c1)C1CCCC1 |
| InChI | InChI=1S/C36H41N2O/c1-22-11-13-26-27-21-25-12-14-28-31(36(4,5)17-16-35(28,2)3)32(25)37-34(27)39-33(26)30(22)29-20-24(15-18-38(29)6)19-23-9-7-8-10-23/h11-15,18,20-21,23H,7-10,16-17,19H2,1-6H3/q+1/i19D2 |
| InChIKey | MRIAQOQZNIFFSX-FKUWIZNHSA-N |
| XLogP | 9.02 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|