C34H42NO+ — CID 176822891
4-(cyclohexylmethyl)-1-methyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)pyridin-1-ium (PubChem CID 176822891) has the molecular formula C34H42NO+ and a molecular weight of 480.72 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-1-methyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)pyridin-1-ium.
| Compound Name | 4-(cyclohexylmethyl)-1-methyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 176822891 |
| Molecular Formula | C34H42NO+ |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | 4-(cyclohexylmethyl)-1-methyl-2-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3ccc4c(c32)C(C)(C)CCC4(C)C)c1-c1cc(CC2CCCCC2)cc[n+]1C |
| InChI | InChI=1S/C34H42NO/c1-22-12-13-25-30-28(15-14-26-31(30)34(4,5)18-17-33(26,2)3)36-32(25)29(22)27-21-24(16-19-35(27)6)20-23-10-8-7-9-11-23/h12-16,19,21,23H,7-11,17-18,20H2,1-6H3/q+1 |
| InChIKey | QKFAQFFHVWCYAY-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|