C26H29N2O+ — CID 176822545
3,3,6,6,14-pentamethyl-13-(1-methylpyridin-1-ium-2-yl)-11-oxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12,14,16-hexaene (PubChem CID 176822545) has the molecular formula C26H29N2O+ and a molecular weight of 385.53 g/mol. Its IUPAC name is 3,3,6,6,14-pentamethyl-13-(1-methylpyridin-1-ium-2-yl)-11-oxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12,14,16-hexaene.
| Compound Name | 3,3,6,6,14-pentamethyl-13-(1-methylpyridin-1-ium-2-yl)-11-oxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12,14,16-hexaene |
|---|---|
| PubChem CID | 176822545 |
| Molecular Formula | C26H29N2O+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3,3,6,6,14-pentamethyl-13-(1-methylpyridin-1-ium-2-yl)-11-oxa-15-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12,14,16-hexaene |
| SMILES | Cc1ncc2c(oc3ccc4c(c32)C(C)(C)CCC4(C)C)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C26H29N2O/c1-16-21(19-9-7-8-14-28(19)6)24-17(15-27-16)22-20(29-24)11-10-18-23(22)26(4,5)13-12-25(18,2)3/h7-11,14-15H,12-13H2,1-6H3/q+1 |
| InChIKey | BMGIAJPKRHAHET-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|