C31H33N2O+ — CID 176822439
1,4-dimethyl-6-(6,17,17,20,20-pentamethyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21)-octaen-5-yl)pyrimidin-1-ium (PubChem CID 176822439) has the molecular formula C31H33N2O+ and a molecular weight of 449.62 g/mol. Its IUPAC name is 1,4-dimethyl-6-(6,17,17,20,20-pentamethyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21)-octaen-5-yl)pyrimidin-1-ium.
| Compound Name | 1,4-dimethyl-6-(6,17,17,20,20-pentamethyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21)-octaen-5-yl)pyrimidin-1-ium |
|---|---|
| PubChem CID | 176822439 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 1,4-dimethyl-6-(6,17,17,20,20-pentamethyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16(21)-octaen-5-yl)pyrimidin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c3ccc3ccc4c(c32)C(C)(C)CCC4(C)C)[n+](C)cn1 |
| InChI | InChI=1S/C31H33N2O/c1-18-8-11-21-22-12-9-20-10-13-23-27(31(5,6)15-14-30(23,3)4)26(20)29(22)34-28(21)25(18)24-16-19(2)32-17-33(24)7/h8-13,16-17H,14-15H2,1-7H3/q+1 |
| InChIKey | RXMKDRBFBGWJMU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|