C21H19N2+ — CID 147766854
1,4-dimethyl-6-(3-methylphenanthren-4-yl)pyrimidin-1-ium (PubChem CID 147766854) has the molecular formula C21H19N2+ and a molecular weight of 299.40 g/mol. Its IUPAC name is 1,4-dimethyl-6-(3-methylphenanthren-4-yl)pyrimidin-1-ium.
| Compound Name | 1,4-dimethyl-6-(3-methylphenanthren-4-yl)pyrimidin-1-ium |
|---|---|
| PubChem CID | 147766854 |
| Molecular Formula | C21H19N2+ |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1,4-dimethyl-6-(3-methylphenanthren-4-yl)pyrimidin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3ccc4ccccc4c23)[n+](C)cn1 |
| InChI | InChI=1S/C21H19N2/c1-14-8-9-17-11-10-16-6-4-5-7-18(16)21(17)20(14)19-12-15(2)22-13-23(19)3/h4-13H,1-3H3/q+1 |
| InChIKey | BPFBAGIQVGOTMS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|