C21H19N4+ — CID 159475397
1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-11H-indolo[1,2-a]benzimidazole (PubChem CID 159475397) has the molecular formula C21H19N4+ and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 159475397 |
| Molecular Formula | C21H19N4+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-11H-indolo[1,2-a]benzimidazole |
| SMILES | Cc1cc(-c2c(C)ccc3c2Cc2nc4ccccc4n2-3)[n+](C)cn1 |
| InChI | InChI=1S/C21H19N4/c1-13-8-9-17-15(21(13)19-10-14(2)22-12-24(19)3)11-20-23-16-6-4-5-7-18(16)25(17)20/h4-10,12H,11H2,1-3H3/q+1 |
| InChIKey | GRPNDQAUBMJZEE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|