C23H22N3+ — CID 161473688
1-(1,4-dimethylpyridin-1-ium-2-yl)-2-methyl-4-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole (PubChem CID 161473688) has the molecular formula C23H22N3+ and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(1,4-dimethylpyridin-1-ium-2-yl)-2-methyl-4-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 1-(1,4-dimethylpyridin-1-ium-2-yl)-2-methyl-4-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 161473688 |
| Molecular Formula | C23H22N3+ |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-(1,4-dimethylpyridin-1-ium-2-yl)-2-methyl-4-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C)cc[n+]2C)c2c1-n1c(nc3ccccc31)C2 |
| InChI | InChI=1S/C23H22N3/c1-14-9-10-25(4)20(11-14)22-15(2)12-16(3)23-17(22)13-21-24-18-7-5-6-8-19(18)26(21)23/h5-12H,13H2,1-4H3/q+1/i3D3 |
| InChIKey | UCIYREUSIOGRFA-HPRDVNIFSA-N |
| XLogP | 4.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|