C19H20N3+ — CID 160547713
6-methyl-5-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-(trideuteriomethyl)-4H-imidazo[1,2-a]indole (PubChem CID 160547713) has the molecular formula C19H20N3+ and a molecular weight of 296.43 g/mol. Its IUPAC name is 6-methyl-5-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-(trideuteriomethyl)-4H-imidazo[1,2-a]indole.
| Compound Name | 6-methyl-5-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-(trideuteriomethyl)-4H-imidazo[1,2-a]indole |
|---|---|
| PubChem CID | 160547713 |
| Molecular Formula | C19H20N3+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 6-methyl-5-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-(trideuteriomethyl)-4H-imidazo[1,2-a]indole |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)cc(C([2H])([2H])[2H])c3c2Cc2nccn2-3)[n+](C)c1 |
| InChI | InChI=1S/C19H20N3/c1-12-5-6-16(21(4)11-12)18-13(2)9-14(3)19-15(18)10-17-20-7-8-22(17)19/h5-9,11H,10H2,1-4H3/q+1/i1D3,3D3 |
| InChIKey | SCXZIQMCIZNCGH-WTJPRRJNSA-N |
| XLogP | 3.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|