C23H28N2+2 — CID 140944282
2-[3-(1,5-dimethylpyridin-1-ium-2-yl)-2,4,6-trimethylphenyl]-1,5-dimethylpyridin-1-ium (PubChem CID 140944282) has the molecular formula C23H28N2+2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-[3-(1,5-dimethylpyridin-1-ium-2-yl)-2,4,6-trimethylphenyl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[3-(1,5-dimethylpyridin-1-ium-2-yl)-2,4,6-trimethylphenyl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 140944282 |
| Molecular Formula | C23H28N2+2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[3-(1,5-dimethylpyridin-1-ium-2-yl)-2,4,6-trimethylphenyl]-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)cc(C)c(-c3ccc(C)c[n+]3C)c2C)[n+](C)c1 |
| InChI | InChI=1S/C23H28N2/c1-15-8-10-20(24(6)13-15)22-17(3)12-18(4)23(19(22)5)21-11-9-16(2)14-25(21)7/h8-14H,1-7H3/q+2 |
| InChIKey | IUCSAOANZOEWAF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|