C15H15N2+ — CID 177271047
4-(1,5-dimethylpyridin-1-ium-2-yl)-3-methylbenzonitrile (PubChem CID 177271047) has the molecular formula C15H15N2+ and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-(1,5-dimethylpyridin-1-ium-2-yl)-3-methylbenzonitrile.
| Compound Name | 4-(1,5-dimethylpyridin-1-ium-2-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 177271047 |
| Molecular Formula | C15H15N2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-(1,5-dimethylpyridin-1-ium-2-yl)-3-methylbenzonitrile |
| SMILES | Cc1ccc(-c2ccc(C#N)cc2C)[n+](C)c1 |
| InChI | InChI=1S/C15H15N2/c1-11-4-7-15(17(3)10-11)14-6-5-13(9-16)8-12(14)2/h4-8,10H,1-3H3/q+1 |
| InChIKey | DDUVDHPZXUVDGP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|