C21H27N2+ — CID 167357486
2-[6-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-2-methylpropanenitrile (PubChem CID 167357486) has the molecular formula C21H27N2+ and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-[6-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-2-methylpropanenitrile.
| Compound Name | 2-[6-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 167357486 |
| Molecular Formula | C21H27N2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 2-[6-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-2-methylpropanenitrile |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1ccc(C(C)(C)C#N)c[n+]1C |
| InChI | InChI=1S/C21H27N2/c1-15-12-16(20(2,3)4)8-10-18(15)19-11-9-17(13-23(19)7)21(5,6)14-22/h8-13H,1-7H3/q+1 |
| InChIKey | KDPWZQDTMTYBJJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|