C24H36NSi+ — CID 167357945
2-(4-tert-butyl-2-methylphenyl)-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium (PubChem CID 167357945) has the molecular formula C24H36NSi+ and a molecular weight of 366.65 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167357945 |
| Molecular Formula | C24H36NSi+ |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1ccc(C2CC[Si](C)(C)CC2)c[n+]1C |
| InChI | InChI=1S/C24H36NSi/c1-18-16-21(24(2,3)4)9-10-22(18)23-11-8-20(17-25(23)5)19-12-14-26(6,7)15-13-19/h8-11,16-17,19H,12-15H2,1-7H3/q+1 |
| InChIKey | DTZCGVWEBIEDMC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|