C28H42NSi+ — CID 167357626
2-[4-(2-cyclopentylpropan-2-yl)-2-methylphenyl]-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium (PubChem CID 167357626) has the molecular formula C28H42NSi+ and a molecular weight of 420.74 g/mol. Its IUPAC name is 2-[4-(2-cyclopentylpropan-2-yl)-2-methylphenyl]-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-[4-(2-cyclopentylpropan-2-yl)-2-methylphenyl]-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167357626 |
| Molecular Formula | C28H42NSi+ |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | 2-[4-(2-cyclopentylpropan-2-yl)-2-methylphenyl]-5-(1,1-dimethylsilinan-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1cc(C(C)(C)C2CCCC2)ccc1-c1ccc(C2CC[Si](C)(C)CC2)c[n+]1C |
| InChI | InChI=1S/C28H42NSi/c1-21-19-25(28(2,3)24-9-7-8-10-24)12-13-26(21)27-14-11-23(20-29(27)4)22-15-17-30(5,6)18-16-22/h11-14,19-20,22,24H,7-10,15-18H2,1-6H3/q+1 |
| InChIKey | GDLXJPWZDYOBKP-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|