C22H30N+ — CID 167358193
2-(4-tert-butyl-2-methylphenyl)-5-(1-deuteriocyclopentyl)-1-methylpyridin-1-ium (PubChem CID 167358193) has the molecular formula C22H30N+ and a molecular weight of 309.50 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)-5-(1-deuteriocyclopentyl)-1-methylpyridin-1-ium.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)-5-(1-deuteriocyclopentyl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167358193 |
| Molecular Formula | C22H30N+ |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)-5-(1-deuteriocyclopentyl)-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3ccc(C(C)(C)C)cc3C)[n+](C)c2)CCCC1 |
| InChI | InChI=1S/C22H30N/c1-16-14-19(22(2,3)4)11-12-20(16)21-13-10-18(15-23(21)5)17-8-6-7-9-17/h10-15,17H,6-9H2,1-5H3/q+1/i17D |
| InChIKey | YTZSJZYMSOKAKY-OKWSDYJOSA-N |
| XLogP | 5.44 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|