C26H38N+ — CID 167357583
2-(4-tert-butyl-2-methylphenyl)-5-(2-cyclopentylpropan-2-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 167357583) has the molecular formula C26H38N+ and a molecular weight of 364.60 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)-5-(2-cyclopentylpropan-2-yl)-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)-5-(2-cyclopentylpropan-2-yl)-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 167357583 |
| Molecular Formula | C26H38N+ |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)-5-(2-cyclopentylpropan-2-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cc(C)c(C(C)(C)C2CCCC2)c[n+]1C |
| InChI | InChI=1S/C26H38N/c1-18-15-21(25(3,4)5)13-14-22(18)24-16-19(2)23(17-27(24)8)26(6,7)20-11-9-10-12-20/h13-17,20H,9-12H2,1-8H3/q+1 |
| InChIKey | BTKHWKMHXUKTBY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|