C25H38GeN+ — CID 160731296
[2-(5-tert-butyl-2-methylphenyl)-5-cyclopentyl-1-methylpyridin-1-ium-4-yl]-trimethylgermane (PubChem CID 160731296) has the molecular formula C25H38GeN+ and a molecular weight of 425.20 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methylphenyl)-5-cyclopentyl-1-methylpyridin-1-ium-4-yl]-trimethylgermane.
| Compound Name | [2-(5-tert-butyl-2-methylphenyl)-5-cyclopentyl-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
|---|---|
| PubChem CID | 160731296 |
| Molecular Formula | C25H38GeN+ |
| Molecular Weight | 425.20 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [2-(5-tert-butyl-2-methylphenyl)-5-cyclopentyl-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
| SMILES | Cc1ccc(C(C)(C)C)cc1-c1cc([Ge](C)(C)C)c(C2CCCC2)c[n+]1C |
| InChI | InChI=1S/C25H38GeN/c1-18-13-14-20(25(2,3)4)15-21(18)24-16-23(26(5,6)7)22(17-27(24)8)19-11-9-10-12-19/h13-17,19H,9-12H2,1-8H3/q+1 |
| InChIKey | BGUKEYKZNPRKCJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.20 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|