C20H26N+ — CID 167365538
2-(5-cyclopentyl-2-methylphenyl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 167365538) has the molecular formula C20H26N+ and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-(5-cyclopentyl-2-methylphenyl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(5-cyclopentyl-2-methylphenyl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 167365538 |
| Molecular Formula | C20H26N+ |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 2-(5-cyclopentyl-2-methylphenyl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2cc(C3CCCC3)ccc2C)[n+](C)cc1C |
| InChI | InChI=1S/C20H26N/c1-14-9-10-18(17-7-5-6-8-17)12-19(14)20-11-15(2)16(3)13-21(20)4/h9-13,17H,5-8H2,1-4H3/q+1 |
| InChIKey | RIBMSXADIXQPTO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|