C26H40NSi+ — CID 167365158
[6-(5-cyclohexyl-2-methylphenyl)-1-methyl-4-(2-methylpropyl)pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 167365158) has the molecular formula C26H40NSi+ and a molecular weight of 394.70 g/mol. Its IUPAC name is [6-(5-cyclohexyl-2-methylphenyl)-1-methyl-4-(2-methylpropyl)pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [6-(5-cyclohexyl-2-methylphenyl)-1-methyl-4-(2-methylpropyl)pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 167365158 |
| Molecular Formula | C26H40NSi+ |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [6-(5-cyclohexyl-2-methylphenyl)-1-methyl-4-(2-methylpropyl)pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | Cc1ccc(C2CCCCC2)cc1-c1cc(CC(C)C)c([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C26H40NSi/c1-19(2)15-23-17-25(27(4)18-26(23)28(5,6)7)24-16-22(14-13-20(24)3)21-11-9-8-10-12-21/h13-14,16-19,21H,8-12,15H2,1-7H3/q+1 |
| InChIKey | MPKSXSWDOCUJDO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|