C22H30N+ — CID 123552926
2-(4-cyclohexyl-2-methylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium (PubChem CID 123552926) has the molecular formula C22H30N+ and a molecular weight of 308.49 g/mol. Its IUPAC name is 2-(4-cyclohexyl-2-methylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(4-cyclohexyl-2-methylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 123552926 |
| Molecular Formula | C22H30N+ |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2-(4-cyclohexyl-2-methylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc(C2CCCCC2)ccc1-c1ccc(C(C)C)c[n+]1C |
| InChI | InChI=1S/C22H30N/c1-16(2)20-11-13-22(23(4)15-20)21-12-10-19(14-17(21)3)18-8-6-5-7-9-18/h10-16,18H,5-9H2,1-4H3/q+1 |
| InChIKey | KTWSPFAKLRVGKT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|