C28H40N+ — CID 167358019
5-cyclohexyl-1-methyl-2-[2-methyl-4-(1,4,4-trimethylcyclohexyl)phenyl]pyridin-1-ium (PubChem CID 167358019) has the molecular formula C28H40N+ and a molecular weight of 390.64 g/mol. Its IUPAC name is 5-cyclohexyl-1-methyl-2-[2-methyl-4-(1,4,4-trimethylcyclohexyl)phenyl]pyridin-1-ium.
| Compound Name | 5-cyclohexyl-1-methyl-2-[2-methyl-4-(1,4,4-trimethylcyclohexyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 167358019 |
| Molecular Formula | C28H40N+ |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 5-cyclohexyl-1-methyl-2-[2-methyl-4-(1,4,4-trimethylcyclohexyl)phenyl]pyridin-1-ium |
| SMILES | Cc1cc(C2(C)CCC(C)(C)CC2)ccc1-c1ccc(C2CCCCC2)c[n+]1C |
| InChI | InChI=1S/C28H40N/c1-21-19-24(28(4)17-15-27(2,3)16-18-28)12-13-25(21)26-14-11-23(20-29(26)5)22-9-7-6-8-10-22/h11-14,19-20,22H,6-10,15-18H2,1-5H3/q+1 |
| InChIKey | XQXVSOREKWXBNE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|