C27H40N+ — CID 167357700
4,5-ditert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclopentyl)phenyl]pyridin-1-ium (PubChem CID 167357700) has the molecular formula C27H40N+ and a molecular weight of 378.62 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclopentyl)phenyl]pyridin-1-ium.
| Compound Name | 4,5-ditert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclopentyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 167357700 |
| Molecular Formula | C27H40N+ |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 4,5-ditert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclopentyl)phenyl]pyridin-1-ium |
| SMILES | Cc1cc(C2(C)CCCC2)ccc1-c1cc(C(C)(C)C)c(C(C)(C)C)c[n+]1C |
| InChI | InChI=1S/C27H40N/c1-19-16-20(27(8)14-10-11-15-27)12-13-21(19)24-17-22(25(2,3)4)23(18-28(24)9)26(5,6)7/h12-13,16-18H,10-11,14-15H2,1-9H3/q+1 |
| InChIKey | ZGBANRYIIRTHAI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|