C24H36N+ — CID 153461096
2-(2,4-dimethylphenyl)-1-methyl-4,5-bis(2-methylbutan-2-yl)pyridin-1-ium (PubChem CID 153461096) has the molecular formula C24H36N+ and a molecular weight of 338.56 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-methyl-4,5-bis(2-methylbutan-2-yl)pyridin-1-ium.
| Compound Name | 2-(2,4-dimethylphenyl)-1-methyl-4,5-bis(2-methylbutan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 153461096 |
| Molecular Formula | C24H36N+ |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-methyl-4,5-bis(2-methylbutan-2-yl)pyridin-1-ium |
| SMILES | CCC(C)(C)c1cc(-c2ccc(C)cc2C)[n+](C)cc1C(C)(C)CC |
| InChI | InChI=1S/C24H36N/c1-10-23(5,6)20-15-22(19-13-12-17(3)14-18(19)4)25(9)16-21(20)24(7,8)11-2/h12-16H,10-11H2,1-9H3/q+1 |
| InChIKey | IGYVGTLWQLGGPG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|