C19H24NO+ — CID 59546734
1-[6-(2,4-dimethylphenyl)-1-methylpyridin-1-ium-3-yl]-2,2-dimethylpropan-1-one (PubChem CID 59546734) has the molecular formula C19H24NO+ and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[6-(2,4-dimethylphenyl)-1-methylpyridin-1-ium-3-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[6-(2,4-dimethylphenyl)-1-methylpyridin-1-ium-3-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59546734 |
| Molecular Formula | C19H24NO+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[6-(2,4-dimethylphenyl)-1-methylpyridin-1-ium-3-yl]-2,2-dimethylpropan-1-one |
| SMILES | Cc1ccc(-c2ccc(C(=O)C(C)(C)C)c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C19H24NO/c1-13-7-9-16(14(2)11-13)17-10-8-15(12-20(17)6)18(21)19(3,4)5/h7-12H,1-6H3/q+1 |
| InChIKey | KLZSHJCMGKKLSQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|