C21H24N3+ — CID 167358214
2-[4-[5-(2-cyanopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-3-methylphenyl]-2-methylpropanenitrile (PubChem CID 167358214) has the molecular formula C21H24N3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-[4-[5-(2-cyanopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-3-methylphenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[5-(2-cyanopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-3-methylphenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 167358214 |
| Molecular Formula | C21H24N3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2-[4-[5-(2-cyanopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-3-methylphenyl]-2-methylpropanenitrile |
| SMILES | Cc1cc(C(C)(C)C#N)ccc1-c1ccc(C(C)(C)C#N)c[n+]1C |
| InChI | InChI=1S/C21H24N3/c1-15-11-16(20(2,3)13-22)7-9-18(15)19-10-8-17(12-24(19)6)21(4,5)14-23/h7-12H,1-6H3/q+1 |
| InChIKey | NYHQHSQQLLOXPN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|